| Identification | |
| Name: | 3-Pyridinecarbonitrile,6-fluoro-2-methyl- |
| Synonyms: | 6-Fluoro-2-methylnicotinonitrile |
| CAS: | 375368-85-7 |
| Molecular Formula: | C7H5 F N2 |
| Molecular Weight: | 136.13 |
| InChI: | InChI=1/C7H5FN2/c1-5-6(4-9)2-3-7(8)10-5/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 92.8°C |
| Boiling Point: | 229.9°C at 760 mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.506 |
| Specification: |
3-Pyridinecarbonitrile,6-fluoro-2-methyl- , its cas register number is 375368-85-7. It also can be called 6-Fluoro-2-methylnicotinonitrile ; 3-Cyano-6-fluoro-2-methylpyridine ; 5-Cyano-2-fluoro-6-picoline . 3-Pyridinecarbonitrile,6-fluoro-2-methyl- (CAS NO.375368-85-7) is irritating to eyes, respiratory system and skin. When it is heated, it may cause an explosion. |
| Flash Point: | 92.8°C |
| Safety Data | |
 |
|
