| Identification | |
| Name: | 1H-Pyrazole-4-carboxylicacid, ethyl ester |
| Synonyms: | Pyrazole-4-carboxylicacid, ethyl ester (7CI);4-Ethoxycarbonyl-1H-pyrazole;Ethyl1H-pyrazole-4-carboxylate;Ethyl 4-pyrazolecarboxylate; |
| CAS: | 37622-90-5 |
| Molecular Formula: | C6H8N2O2 |
| Molecular Weight: | 140.14 |
| InChI: | InChI=1/C6H8N2O2/c1-2-10-6(9)5-3-7-8-4-5/h3-4H,2H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.214 g/cm3 |
| Refractive index: | 1.515 |
| Appearance: | White to yellow crystalline powder |
| Specification: |
Ethyl pyrazole-4-carboxylate , its cas register number is 37622-90-5. It also can be called Ethyl 4-pyrazolecarboxylate ; and 4-Acetylpyrazole . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
