| Identification | |
| Name: | Acetic acid,2-(2,4-dichlorophenoxy)-, lithium salt (1:1) |
| Synonyms: | Aceticacid, (2,4-dichlorophenoxy)-, lithium salt (8CI,9CI); 2,4-D lithium salt;Lithium 2,4-dichlorophenoxyacetate |
| CAS: | 3766-27-6 |
| Molecular Formula: | C8H6 Cl2 O3 . Li |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H6Cl2O3.Li/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 138 deg C |
| Flash Point: | 162.8°C |
| Boiling Point: | 345.6°C at 760 mmHg |
| Flash Point: | 162.8°C |
| Color: | White to yellow crystalline powder /SRP: yellow color is phenolic impurities/ Colorless powder White to yellow, crystalline ... powder. Crystals from benzene |
| Safety Data | |
 |
|
