| Identification | |
| Name: | Benzene,1,3-bis(phenylmethoxy)- |
| Synonyms: | Benzene,m-bis(benzyloxy)- (6CI,7CI,8CI); 1,3-Bis(benzyloxy)benzene;1,3-Dibenzyloxybenzene; Resorcinol dibenzyl ether |
| CAS: | 3769-42-4 |
| Molecular Formula: | C20H18O2 |
| Molecular Weight: | 290.36 |
| InChI: | InChI=1/C20H18O2/c1-3-8-17(9-4-1)15-21-19-12-7-13-20(14-19)22-16-18-10-5-2-6-11-18/h1-14H,15-16H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.121 g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
The cas register number of 1,3-Dibenzyloxybenzene is 3769-42-4. It also can be called as Benzene,1,3-bis(phenylmethoxy)- and the Systematic name about this chemical is 1,3-bis(benzyloxy)benzene. Physical properties about 1,3-Dibenzyloxybenzene are: (1)ACD/LogP: 5.24; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.24; (4)ACD/LogD (pH 7.4): 5.24; (5)ACD/BCF (pH 5.5): 5654.88; (6)ACD/BCF (pH 7.4): 5654.88; (7)ACD/KOC (pH 5.5): 16887.94; (8)ACD/KOC (pH 7.4): 16887.94; (9)#H bond acceptors: 2 ; (10)#Freely Rotating Bonds: 6; (11)Polar Surface Area: 18.46Å2; (12)Index of Refraction: 1.6; (13)Molar Refractivity: 88.58 cm3; (14)Molar Volume: 258.8 cm3; (15)Polarizability: 35.1x10-24cm3; (16)Surface Tension: 43.5 dyne/cm; (17)Enthalpy of Vaporization: 67.05 kJ/mol; (18)Vapour Pressure: 1.54E-07 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
