| Identification | |
| Name: | 4-Pyrazolecarboxylic acid |
| Synonyms: | 1H-Pyrazole-4-carboxylicacid;Pyrazole-4-carboxylicacid (6CI,7CI);4-Carboxypyrazole;Pyrazole-4-carboxylic acid;1H-Pyrazole-4-carboxylic acid; |
| CAS: | 37718-11-9 |
| EINECS: | 253-641-5 |
| Molecular Formula: | C4H4N2O2 |
| Molecular Weight: | 112.09 |
| InChI: | InChI=1/C4H4N2O2/c7-4(8)3-1-5-6-2-3/h1-2H,(H,5,6)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.524 g/cm3 |
| Refractive index: | 1.616 |
| Appearance: | Off-white powder |
| Specification: |
1H-Pyrazole-4-carboxylic acid , its cas register number is 37718-11-9. It also can be called 4-Pyrazolecarboxylic acid ; and 1H-Pyrazole-4-carboxylicacid . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
