| Identification | |
| Name: | Benzenamine,2-[(4-chlorophenyl)thio]- |
| Synonyms: | Aniline,o-[(p-chlorophenyl)thio]- (6CI,7CI); 2-Aminophenyl 4-chlorophenyl sulfide;o-(p-Chlorophenylthio)aniline |
| CAS: | 37750-29-1 |
| Molecular Formula: | C12H10 Cl N S |
| Molecular Weight: | 235.73 |
| InChI: | InChI=1/C12H10ClNS/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8H,14H2 |
| Molecular Structure: | ![(C12H10ClNS) Aniline,o-[(p-chlorophenyl)thio]- (6CI,7CI); 2-Aminophenyl 4-chlorophenyl sulfide;o-(p-Chlorophenylt...](https://img1.guidechem.com/chem/e/dict/24/37750-29-1.jpg) |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Flash Point: | 6 °C |
| Boiling Point: | 371.6°C at 760 mmHg |
| Density: | 1.31g/cm3 |
| Refractive index: | n20/D 1.574 |
| Specification: |
2-(4-Chlorophenylthio)aniline , its cas register number is 37750-29-1. It also can be called 2-Amino-4'-chloro diphenyl sulfide ; 2-[(4-chlorophenyl)thio]aniline ; and 2-Aminophenyl 4-chlorophenyl sulfide . |
| Flash Point: | 6 °C |
| Safety Data | |
 |
|
