| Identification | |
| Name: | Boron,trifluoro(2-propanamine)-, (T-4)- |
| Synonyms: | 2-Propanamine,compd. with trifluoroborane (1:1); Isopropylamine, compd. with BF3 (7CI);Isopropylamine, compd. with boron fluoride (BF3) (1:1) (8CI); Borane,trifluoro-, compd. with 2-propanamine (1:1); Boron fluoride (BF3), compd. withisopropylamine (1:1); Anchor 1115; Anchor Curing Agent 1115; Borontrifluoride-isopropylamine complex; Isopropylamine-boron trifluoride complex |
| CAS: | 3776-04-3 |
| EINECS: | 223-230-5 |
| Molecular Formula: | C3H9 B F3 N |
| Molecular Weight: | 126.9164696 |
| InChI: | InChI=1/C3H9N.B.3FH/c1-3(2)4;;;;/h3H,4H2,1-2H3;;3*1H/q;+3;;;/p-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 30.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
