| Identification |
| Name: | Benzene,1,1'-[1,2-ethanediylbis(oxy)]bis[2,4,6-tribromo- |
| Synonyms: | 1,2-Bis(2,4,6-tribromophenoxy)ethane;FF 680;FI 680;FM 680;FireMaster 680;FireMaster FF 680; |
| CAS: | 37853-59-1 |
| EINECS: | 253-692-3 |
| Molecular Formula: | C14H8 Br6 O2 |
| Molecular Weight: | 687.64 |
| InChI: | InChI=1/C14H8Br6O2/c15-7-3-9(17)13(10(18)4-7)21-1-2-22-14-11(19)5-8(16)6-12(14)20/h3-6H,1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3152 |
| Melting Point: | 222 - 223 |
| Flash Point: | 238.8°C |
| Boiling Point: | 566.4°Cat760mmHg |
| Density: | 2.327g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.666 |
| Solubility: | Insoluble |
| Appearance: | White powder. |
| Packinggroup: | II |
| Flash Point: | 238.8°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | White, crystalline powder |
| Usage: | Flame retardant. |
| Safety Data |
| |
 |
