| Identification | |
| Name: | Methanone,(2-aminophenyl)(4-fluorophenyl)- |
| Synonyms: | Benzophenone,2-amino-4'-fluoro- (6CI,8CI);2-Aminophenyl4-fluorophenyl ketone;o-(p-Fluorobenzoyl)aniline; |
| CAS: | 3800-06-4 |
| Molecular Formula: | C13H10NOF |
| Molecular Weight: | 215.23 |
| InChI: | InChI=1/C13H10FNO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H,15H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.237 g/cm3 |
| Refractive index: | 1.609 |
| Specification: |
2-Amino-4'-fluorobenzophenone , its cas register number is 3800-06-4. It also can be called Methanone, (2-aminophenyl)(4-fluorophenyl)- . |
| Usage: | An intermediate in the preparation of the anticholesteremic Pitavastatin. |
| Safety Data | |
 |
|
