| Identification | |
| Name: | 2H-Pyran-4-amine,tetrahydro-N,N-dimethyl- |
| Synonyms: | 4-(Dimethylamino)tetrahydro-2H-pyran;N,N-dimethyltetrahydro-2H-pyran-4-amine;2H-pyran-4-amine, tetrahydro-N,N-dimethyl-;4-(Dimethylamino)tetrahydro-2H-pyran;tetrahydro-N,N-dimethyl-2H-pyran-4-amine; |
| CAS: | 38035-10-8 |
| Molecular Formula: | C7H15NO |
| Molecular Weight: | 129.20 |
| InChI: | InChI=1/C7H15NO/c1-8(2)7-3-5-9-6-4-7/h7H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 47.3°C |
| Boiling Point: | 172.3°Cat760mmHg |
| Density: | 0.92g/cm3 |
| Refractive index: | 1.458 |
| Specification: |
The 4-(Dimethylamino)tetrahydro-2H-pyran, with the cas registry number 38035-10-8, has the systematic name of N,N-dimethyltetrahydro-2H-pyran-4-amine. And the molecular formula of the chemical is C7H15NO. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.05; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 12.47 Å2; (7)Index of Refraction: 1.458; (8)Molar Refractivity: 38.008 cm3; (9)Molar Volume: 139.189 cm3; (10)Polarizability: 15.067×10-24cm3; (11)Surface Tension: 29.865 dyne/cm; (12)Density: 0.928 g/cm3; (13)Flash Point: 47.284 °C; (14)Enthalpy of Vaporization: 40.865 kJ/mol; (15)Boiling Point: 172.28 °C at 760 mmHg; (16)Vapour Pressure: 1.341 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 47.3°C |
| Safety Data | |
 |
|
