| Identification | |
| Name: | 4H-1,3,2-Benzodioxaphosphorin,2-methoxy-, 2-sulfide |
| Synonyms: | Phosphorothioicacid, O-methyl ester, cyclic O,O-ester with o-hydroxybenzyl alcohol (7CI);Phosphorothioic acid, cyclic O,O-(methylene-o-phenylene) O-methyl ester (8CI);Benzyl alcohol, o-hydroxy-, cyclic O,O-ester with O-methyl phosphorothioate(8CI); 2-Methoxy-4H-1,3,2-benzodioxaphorphorin-2-sulfide;2-Methoxy-4H-1,3,2-benzodioxaphospholin-2-sulfide; 2-Methoxy-4H-1,3,2-benzodioxaphosphorin-2-sulfide;Dioxabenzofos; Dioxabenzophos; Fenfosphorin; Saligenin cyclic methylphosphorothionate; Salithion |
| CAS: | 3811-49-2 |
| EINECS: | 223-292-3 |
| Molecular Formula: | C8H9 O3 P S |
| Molecular Weight: | 216.20 |
| InChI: | InChI=1/C8H9O3PS/c1-9-12(13)10-6-7-4-2-3-5-8(7)11-12/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2783 |
| Flash Point: | 119.8°C |
| Boiling Point: | 274.4°Cat760mmHg |
| Density: | 1.37g/cm3 |
| Refractive index: | 1.59 |
| Water Solubility: | 43 mg l-1 |
| Specification: |
2-Methoxy-4H-1,2,3-benzodioxaphosphorine-2-sulfide ,its CAS NO. is 3811-49-2,the synonyms is 2-Methoxy-4H-1,3,2-lambda-5-benzodioxaphosphinine 2-sulphide ; 2-Methoxy-4H-benzo-1,3,2-dioxaphosphorin 2-sulphide ; Phosphorothioic acid, cyclic O,O-(methylene-o-phenylene) O-methyl ester ; Salithion ; 4H-(1.3.2)Benzodioxaphosphorine, 2-methoxy-, 2-sulfide ; Salithion-sumitomo . |
| Packinggroup: | III |
| Flash Point: | 119.8°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
