| Identification | |
| Name: | Pentanoyl chloride,4-methyl- |
| Synonyms: | 4-Methylpentanoylchloride;4-Methylvaleric acid chloride;4-Methylvaleroyl chloride;4-Methylvaleryl chloride;Isocaproyl chloride;Isohexanoyl chloride;g-Methylvaleroyl chloride;g-Methylvaleryl chloride; |
| CAS: | 38136-29-7 |
| EINECS: | 253-801-4 |
| Molecular Formula: | C6H11ClO |
| Molecular Weight: | 134.6 |
| InChI: | InChI=1/C6H11ClO/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.986 g/cm3 |
| Refractive index: | 1.422 |
| Specification: |
The 4-Methylvaleryl chloride with the cas number 38136-29-7 is also called Pentanoyl chloride,4-methyl-. Its EINECS registry number is 253-801-4. The molecular formula is C6H11ClO. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.40; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.4; (4)ACD/LogD (pH 7.4): 2.4; (5)ACD/BCF (pH 5.5): 39.17; (6)ACD/BCF (pH 7.4): 39.17; (7)ACD/KOC (pH 5.5): 480.71; (8)ACD/KOC (pH 7.4): 480.71; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 17.07 Å2; (13)Index of Refraction: 1.422; (14)Molar Refractivity: 34.68 cm3; (15)Molar Volume: 136.4 cm3; (16)Polarizability: 13.74×10-24cm3; (17)Surface Tension: 27.2 dyne/cm; (18)Enthalpy of Vaporization: 37.76 kJ/mol; (19)Vapour Pressure: 6.15 mmHg at 25°C. Preparation: This chemical can be prepared by 4-methyl-pentanoic acid. This reaction needs reagent SOCl2 at temperature of 50 °C. Uses: This chemical can react with methylbenzene to product 4-methyl-1-p-tolyl-pentan-1-one. This reaction needs reagent AlCl3. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
