Identification |
Name: | 2-Propenamide, 2-methyl-, polymer with 1-ethenyl-2-pyrrolidinone |
Synonyms: | 2-Propenamide, 2-methyl-, polymer with 1-ethenyl-2-pyrrolidinone;2-Propenamide, 2-methyl-, polymer with 1-ethenyl-2-pyrrolidinone 2-Propenamide, 2-methyl-, polymer with 1-ethenyl-2-pyrrolidone 2-methyl-2-propenamid polymer with 1-ethenyl-2-pyrrolidinone |
CAS: | 38139-94-5 |
Molecular Formula: | C10H16N2O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H9NO.C4H7NO/c1-2-7-5-3-4-6(7)8;1-3(2)4(5)6/h2H,1,3-5H2;1H2,2H3,(H2,5,6) |
Molecular Structure: |
 |
Properties |
Flash Point: | 93.9°C |
Boiling Point: | 217.6°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 93.9°C |
Safety Data |
|
 |