| Identification | |
| Name: | Acetic acid,cyano(hydroxyimino)-, (E)- (9CI) |
| Synonyms: | (3E)-3-cyano-3-(methylimino)-2-oxopropanoic acid;propanoic acid, 3-cyano-3-(methylimino)-2-oxo-, (3E)- |
| CAS: | 38157-71-0 |
| Molecular Formula: | C3H2 N2 O3 |
| Molecular Weight: | 140.10 |
| InChI: | InChI=1/C5H4N2O3/c1-7-3(2-6)4(8)5(9)10/h1H3,(H,9,10)/b7-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33 g/cm3 |
| Refractive index: | 1.537 |
| Specification: |
The cas register number of (E)-3-Cyano-3-(methylimino)-2-oxopropanoic acid is 38157-71-0. It also can be called as propanoic acid, 3-cyano-3-(methylimino)-2-oxo-, (3E)- and the Systematic name about this chemical is (3E)-3-cyano-3-methylimino-2-oxo-propanoic acid. Physical properties about (E)-3-Cyano-3-(methylimino)-2-oxopropanoic acid are: (1)# of Rule of 5 Violations: 0; (2)#H bond acceptors: 5; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Polar Surface Area: 90.52Å2; (6)Index of Refraction: 1.537; (7)Molar Refractivity: 32.92 cm3; (8)Molar Volume: 105.3 cm3; (9)Surface Tension: 52.6 dyne/cm; (10)Density: 1.33 g/cm3; (11)Flash Point: 135.4 °C; (12)Enthalpy of Vaporization: 59.43 kJ/mol; (13)Boiling Point: 300.2 °C at 760 mmHg; (14)Vapour Pressure: 0.000267 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
