| Identification | |
| Name: | 6-Methoxy-8-(5-propylaminoamylamino)quinoline phosphate |
| Synonyms: | WIN 5037;6-Methoxy-8-(5-propylaminoamylamino)quinoline phosphate;6-Methoxy-8-((5-(propylamino)pentyl)amino)quinoline phosphate;Quinoline, 6-methoxy-8-((5-(propylamino)pentyl)amino)-, phosphate;3818-70-0;AC1L56VJ;LS-142036;1,5-Pentanediamine, N-(6-methoxy-8-quinolinyl)-N'-propyl-, phosphate;N'-(6-methoxyquinolin-8-yl)-N-propylpentane-1,5-diamine; phosphoric acid;N-(6-methoxyquinolin-8-yl)-N'-propylpentane-1,5-diamine phosphate (1:1);1,5-Pentanediamine, N-(6-methoxy-8-quinolinyl)-N'-propyl-, phosphate (9CI) |
| CAS: | 3818-70-0 |
| Molecular Formula: | C18H27N3O . xH3O4P |
| Molecular Weight: | 399.4217 |
| InChI: | InChI=1/C18H27N3O.H3O4P/c1-3-9-19-10-5-4-6-11-20-17-14-16(22-2)13-15-8-7-12-21-18(15)17;1-5(2,3)4/h7-8,12-14,19-20H,3-6,9-11H2,1-2H3;(H3,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 243°C |
| Boiling Point: | 478.1°C at 760 mmHg |
| Specification: |
6-Methoxy-8-(5-propylaminoamylamino)quinoline phosphate , its cas register number is 3818-70-0. It also can be called 6-Methoxy-8-((5-(propylamino)pentyl)amino)quinoline phosphate ; WIN 5037 . When 6-Methoxy-8-(5-propylaminoamylamino)quinoline phosphate (CAS NO.3818-70-0) is heated to decomposition, it emits toxic vapors of NOx and POx. |
| Flash Point: | 243°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
