| Identification |
| Name: | 4H-1-Benzopyran-4-one,7,8-dihydroxy-2-phenyl- |
| Synonyms: | Flavone,7,8-dihydroxy- (6CI);7,8-Dihydroxy-2-phenyl-4H-chromen-4-one;7,8-Dihydroxyflavone; |
| CAS: | 38183-03-8 |
| EINECS: | 253-812-4 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.24 |
| InChI: | InChI=1/C15H10O4/c16-11-7-6-10-12(17)8-13(19-15(10)14(11)18)9-4-2-1-3-5-9/h1-8,16,18H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 243-246°C |
| Flash Point: | 193.5°C |
| Boiling Point: | 494.4°C at 760 mmHg |
| Density: | 1.443g/cm3 |
| Refractive index: | 1.698 |
| Biological Activity: | Tyrosine kinase receptor B (TrkB) agonist that binds to the extracellular domain of the receptor (K d = 320 nM). Inhibits glutamate-triggered apoptosis in hippocampal neurons in vitro and in vivo . |
| Flash Point: | 193.5°C |
| Safety Data |
| |
 |
