Identification |
Name: | 4H-1-Benzopyran-4-one,7,8-dihydroxy-2-phenyl- |
Synonyms: | Flavone,7,8-dihydroxy- (6CI);7,8-Dihydroxy-2-phenyl-4H-chromen-4-one;7,8-Dihydroxyflavone; |
CAS: | 38183-03-8 |
EINECS: | 253-812-4 |
Molecular Formula: | C15H10O4 |
Molecular Weight: | 254.24 |
InChI: | InChI=1/C15H10O4/c16-11-7-6-10-12(17)8-13(19-15(10)14(11)18)9-4-2-1-3-5-9/h1-8,16,18H |
Molecular Structure: |
 |
Properties |
Melting Point: | 243-246°C |
Flash Point: | 193.5°C |
Boiling Point: | 494.4°C at 760 mmHg |
Density: | 1.443g/cm3 |
Refractive index: | 1.698 |
Biological Activity: | Tyrosine kinase receptor B (TrkB) agonist that binds to the extracellular domain of the receptor (K d = 320 nM). Inhibits glutamate-triggered apoptosis in hippocampal neurons in vitro and in vivo . |
Flash Point: | 193.5°C |
Safety Data |
|
 |