| Identification | |
| Name: | Fluorescamine |
| Synonyms: | Fluram |
| CAS: | 38183-12-9 |
| EINECS: | 253-814-5 |
| Molecular Formula: | C17H10O4 |
| Molecular Weight: | 278.26 |
| InChI: | InChI=1/C17H10O4/c18-15-13(11-6-2-1-3-7-11)10-20-17(15)14-9-5-4-8-12(14)16(19)21-17/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1090 3/PG 2 |
| Flash Point: | -17 °C |
| Boiling Point: | Vapour density: |
| Density: | 1.43g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.686 |
| Water Solubility: | slight Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: | slight
|
| Appearance: | white powder |
| Specification: |
Fluorescamine , its cas register number is 38183-12-9. It also can be called 4-Phenylspiro(furan-2(3H),1'(3'H)-isobenzofuran)-3,3'-dione ; Spiro(furan-2(3H),1'(3'H)-isobenzofuran)-3,3'-dione, 4-phenyl- .It is a off-white to yellow powder. |
| Flash Point: | -17 °C |
| Storage Temperature: | 2-8°C |
| Color: | off-white to yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
