| Identification | |
| Name: | 3-Amino-2(1H)-pyridinethione |
| Synonyms: | 2-Pyridinethiol, 3-amino-;2(1H)-Pyridinethione,3-amino-(9CI);3-aminopyridine-2(1H)- thione; |
| CAS: | 38240-21-0 |
| Molecular Formula: | C5H6N2S |
| Molecular Weight: | 126.18 |
| InChI: | InChI=1/C5H6N2S/c6-4-2-1-3-7-5(4)8/h1-3H,6H2,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.31 g/cm3 |
| Refractive index: | 1.7 |
| Specification: |
The 3-Amino-2(1H)-pyridinethione with the CAS number 38240-21-0 is also called 2(1H)-Pyridinethione,3-amino-(9CI). Its molecular formula is C5H6N2S. This chemical belongs to the following product categories: (1)Pyridine; (2)Pharmacetical. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 3-Amino-2(1H)-pyridinethione are: (1)ACD/LogP: -0.35; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.55; (4)ACD/LogD (pH 7.4): -1.56; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 2; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 38.57 Å2; (13)Index of Refraction: 1.7; (14)Molar Refractivity: 37.12 cm3; (15)Molar Volume: 95.9 cm3; (16)Polarizability: 14.71×10-24cm3; (17)Surface Tension: 69.1 dyne/cm; (18)Enthalpy of Vaporization: 46.16 kJ/mol; (19)Vapour Pressure: 0.0879 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
