| Identification | |
| Name: | 1,1'-Biphenyl,3,3',5-trichloro- |
| Synonyms: | 3,3',5-Trichlorobiphenyl;CB 36; PCB 36 |
| CAS: | 38444-87-0 |
| Molecular Formula: | C12H7 Cl3 |
| Molecular Weight: | 257.54 |
| InChI: | InChI=1S/C12H7Cl3/c13-10-3-1-2-8(4-10)9-5-11(14)7-12(15)6-9/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 245.7°C |
| Boiling Point: | 354.5°Cat760mmHg |
| Density: | 1.351g/cm3 |
| Solubility: | IN WATER: 906 PPB 0.22-0.25 mg/l; 0.049 mg/l at 24 deg C composition of the water soluble fraction. In water: 0.085 ppm Water solubility at 25 deg C: 225-250 ug/l |
| Flash Point: | 245.7°C |
| Color: | ... Colorless mobile oil. |
| Safety Data | |
 |
|
