Identification |
Name: | Octanoic acid,4-cyano-2,6-diiodophenyl ester |
Synonyms: | Octanoicacid, ester with 4-hydroxy-3,5-diiodobenzonitrile (7CI,8CI);3,5-Diiodo-4-n-octanoyloxybenzonitrile; 3,5-Diiodo-4-octanoyloxybenzonitrile;Bentrol L; Ioxynil octanoate; MB 11641; Totril |
CAS: | 3861-47-0 |
EINECS: | 223-375-4 |
Molecular Formula: | C15H17 I2 N O2 |
Molecular Weight: | 497.11 |
InChI: | InChI=1/C15H17I2NO2/c1-2-3-4-5-6-7-14(19)20-15-12(16)8-11(10-18)9-13(15)17/h8-9H,2-7H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 |
Flash Point: | 237.8°C |
Boiling Point: | 469.5°Cat760mmHg |
Density: | 1.81g/cm3 |
Report: |
EPA Genetic Toxicology Program. Cyanide and its compounds are on the Community Right-To-Know List.
|
Packinggroup: | III |
Flash Point: | 237.8°C |
Storage Temperature: | 0-6°C |
Safety Data |
|
 |