| Identification |
| Name: | 2-Chloro-6-fluorobenzaldehyde |
| Synonyms: | 2-Choro-6-Fluoro Benzaldehyde |
| CAS: | 387-45-1 |
| EINECS: | 206-860-5 |
| Molecular Formula: | C7H4ClFO |
| Molecular Weight: | 158.55 |
| InChI: | InChI=1/C7H4ClFO/c8-6-2-1-3-7(9)5(6)4-10/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Density: | 1.352 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.559 |
| Water Solubility: | Insoluble |
| Solubility: | insoluble |
| Appearance: | white to yellow solid |
| HS Code: | 29130000 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
