| Identification | |
| Name: | m-Chlorophenyl phenyl sulfide |
| Synonyms: | 3-Chloro-(1,1'-thiobisbenzene);3-Chlorophenylphenyl sulfide;Phenyl 3-chlorophenyl sulfide |
| CAS: | 38700-88-8 |
| Molecular Formula: | C12H9ClS |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H9ClS/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.5°C |
| Boiling Point: | 335.7°C at 760 mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.652 |
| Specification: |
m-Chlorophenyl phenyl sulfide , its cas register number is 38700-88-8. It also can be called Benzene, 1-chloro-3-(phenylthio)- ; and CP 18928 . Its classification code are Skin / Eye Irritant; TSCA Flag P [A commenced PMN (Premanufacture Notice) substance]. |
| Flash Point: | 148.5°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
