| Identification | |
| Name: | 2-(2-Furyl)benzimidazole |
| Synonyms: | VORONIT(R);1H-Benzimidazole, 2-(2-furanyl)-;2-(2-furanyl)-1h-benzimidazol;2-(2-Furyl)-1H-benzimidazole;2-(2-furyl)-benzimidazol;B-33172;BAY 33172;bay33172 |
| CAS: | 3878-19-1 |
| EINECS: | 223-404-0 |
| Molecular Formula: | C11H8N2O |
| Molecular Weight: | 184.19 |
| InChI: | InChI=1/C11H8N2O/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10/h1-7H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2588 |
| Flash Point: | 194.7°C |
| Boiling Point: | 380.6°C at 760 mmHg |
| Density: | 1.286g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
It is a benzimidazole and behaves as an amine. Amines are chemical bases. They neutralize acids to form salts plus water. These acid-base reactions are exothermic. The amount of heat that is evolved per mole of amine in a neutralization is largely independent of the strength of the amine as a base. Amines may be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen is generated by amines in combination with strong reducing agents, such as hydrides. |
| Packinggroup: | III |
| Flash Point: | 194.7°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
