| Identification | |
| Name: | Lapatinib ditosylate |
| Synonyms: | Lapatinib ditosylate anhydrous; benzenesulfonic acid; N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine; hydrate; Lapatinib Ditoyslate; ` |
| CAS: | 388082-77-7 |
| Molecular Formula: | C29H26ClFN4O4S.2(C7H8O3S) |
| Molecular Weight: | 915.422903 |
| InChI: | InChI=1/C29H26ClFN4O4S.2C7H8O3S/c1-40(36,37)12-11-32-16-23-7-10-27(39-23)20-5-8-26-24(14-20)29(34-18-33-26)35-22-6-9-28(25(30)15-22)38-17-19-3-2-4-21(31)13-19;2*1-6-2-4-7(5-3-6)11(8,9)10/h2-10,13-15,18,32H,11-12,16-17H2,1H3,(H,33,34,35);2*2-5H,1H3,(H,8,9,10) |
| Molecular Structure: | ![(C29H26ClFN4O4S.2(C7H8O3S)) Lapatinib ditosylate anhydrous; benzenesulfonic acid; N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]...](https://img.guidechem.com/crawlimg/388082-77-7.jpg) |
| Properties | |
| Melting Point: | 240-2420C |
| Flash Point: | 407.8°C |
| Boiling Point: | 750.7°C at 760 mmHg |
| Appearance: | Yellow solid |
| Flash Point: | 407.8°C |
| Usage: | Reversible dual inhibitor of ErbB1 and ErbB2 tyrosine kinases. Antineoplastic |
| Safety Data | |
 |
|
