| Identification |
| Name: | Ethanone,2-amino-1-(4-methoxyphenyl)-, hydrochloride (1:1) |
| Synonyms: | Acetophenone,2-amino-4'-methoxy-, hydrochloride (7CI,8CI);Ethanone,2-amino-1-(4-methoxyphenyl)-, hydrochloride (9CI);2-Amino-1-(4-methoxyphenyl)ethanone hydrochloride;2-Amino-4'-methoxyacetophenone hydrochloride;a-Amino-p-methoxyacetophenone hydrochloride; |
| CAS: | 3883-94-1 |
| Molecular Formula: | C9H12ClNO2 |
| Molecular Weight: | 201.65 |
| InChI: | InChI=1/C9H11NO2.ClH/c1-12-8-4-2-7(3-5-8)9(11)6-10;/h2-5H,6,10H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 190-193 °C(lit.)
|
| Flash Point: | 166°C |
| Boiling Point: | 315.4°Cat760mmHg |
| Density: | 1.111g/cm3 |
| Appearance: | White to yellow to yellow-tan crystalline powder |
| Flash Point: | 166°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
