| Identification | |
| Name: | D(+)-alpha-Methylbenzylamine |
| CAS: | 3886-69-9 |
| EINECS: | 223-423-4 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 0.95 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.525-1.527 |
| Alpha: | 40 o (NEAT) |
| Solubility: | 40 g/L (20 oC) |
| Appearance: | Colorless to light yellow liqui |
| Specification: |
?Benzenemethanamine, a-methyl-, (aR)- , its cas register number is 3886-69-9. It also can be called?(+/-)-alpha-Methylbenzylamine ; (R,S)-(+/-)-1-Phenylethylamine ; alpha.-Methylbenzylamine ; alpha.-Phenylethylamine ; 1-Phenylethanamin ; 1-Phenylethanamine?; (R)-alpha-Methylbenzenemethanamine . |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Sensitive: | Air Sensitive |
| Color: | WATER-WHITE LIQ |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
