| Identification | |
| Name: | 1-(4-Methoxyphenyl)piperazine dihydrochloride |
| Synonyms: | Piperazine,1-(4-methoxyphenyl)-, dihydrochloride (9CI);1-(p-Methoxyphenyl)piperazine dihydrochloride;4-(4-Methoxyphenyl)piperazine dihydrochloride;N-(4-Methoxyphenyl)piperazinedihydrochloride;1-(4-Methoxyphenyl)piperazine-1,4-diylium dichloride; |
| CAS: | 38869-47-5 |
| EINECS: | 254-166-6 |
| Molecular Formula: | C11H16N2O.2HCl;C11H18Cl2N2O |
| Molecular Weight: | 265.18 |
| InChI: | InChI=1/C11H16N2O.ClH/c1-14-11-4-2-10(3-5-11)13-8-6-12-7-9-13;/h2-5,12H,6-9H2,1H3;1H/p-1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | off-white powder |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Usage: | An intermediate in the synthesis of Itraconazole |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
