| Identification | |
| Name: | Pyrrolidine,2-(4-chlorophenyl)- |
| Synonyms: | 2-(4-Chlorophenyl)pyrrolidine;2-(p-Chlorophenyl)pyrrolidine; |
| CAS: | 38944-14-8 |
| Molecular Formula: | C10H12ClN |
| Molecular Weight: | 181.66 |
| InChI: | InChI=1/C10H12ClN/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h3-6,10,12H,1-2,7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.7°C |
| Boiling Point: | 269.4°Cat760mmHg |
| Density: | 1.129g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
2-(4-Chlorophenyl)pyrrolidine, its cas register number is 38944-14-8. It also can be called 2-(4-Chlorphenyl)pyrrolidin ; 2-[p-Chlorophenyl]pyrolidine ; and pyrrolidine, 2-(4-chlorophenyl)- . |
| Flash Point: | 116.7°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
Xi: Irritant
|
 |
|
