| Identification |
| Name: | Ethanone,1-(3,5-dimethoxyphenyl)- |
| Synonyms: | Acetophenone,3',5'-dimethoxy- (6CI,7CI);1-(3,5-Dimethoxyphenyl)ethanone;3,5-Dimethoxyacetophenone;3',5'-Dimethoxyacetophenone;NSC 46884; |
| CAS: | 39151-19-4 |
| EINECS: | 254-322-3 |
| Molecular Formula: | C10H12O3 |
| Molecular Weight: | 180.2 |
| InChI: | InChI=1/C10H12O3/c1-7(11)8-4-9(12-2)6-10(5-8)13-3/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.066 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.543 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow crystals or crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
