| Identification |
| Name: | Benzeneacetic acid,2-mercapto- |
| Synonyms: | (2-Mercaptophenyl)aceticacid; 2-Mercaptobenzeneacetic acid; o-Mercaptophenylacetic acid |
| CAS: | 39161-85-8 |
| Molecular Formula: | C8H8 O2 S |
| Molecular Weight: | 168.21 |
| InChI: | InChI=1/C8H8O2S/c9-8(10)5-6-3-1-2-4-7(6)11/h1-4,11H,5H2,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 156.2°C |
| Boiling Point: | 334.7°C at 760 mmHg |
| Density: | 1.299g/cm3 |
| Refractive index: | 1.62 |
| Flash Point: | 156.2°C |
| Usage: | A useful synthetic intermediate for the preparation of novel antiinflammatory agents |
| Safety Data |
| |
 |
