| Identification | |
| Name: | 4-Isoxazolecarboxylicacid, 3-(2,6-dichlorophenyl)-5-methyl- |
| Synonyms: | 3-(2,6-Dichlorophenyl)-5-methyl-4-isoxazolylcarboxylicacid; 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid;5-Methyl-3-(2,6-dichlorophenyl)isoxazole-4-carboxylic acid |
| CAS: | 3919-76-4 |
| EINECS: | 223-487-3 |
| Molecular Formula: | C11H7 Cl2 N O3 |
| Molecular Weight: | 272.08 |
| InChI: | InChI=1/C11H7Cl2NO3/c1-5-8(11(15)16)10(14-17-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.8°C |
| Boiling Point: | 383.6°Cat760mmHg |
| Density: | 1.483g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
4-Isoxazolecarboxylicacid, 3-(2,6-dichlorophenyl)-5-methyl- , its cas register number is 3919-76-4. It also can be called 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid ; 5-Methyl-3-(2',6'-dichlorophenyl)-4-isoxazolecarboxylic acid . 4-Isoxazolecarboxylicacid, 3-(2,6-dichlorophenyl)-5-methyl- (CAS NO.3919-76-4) is irritating to eyes, respiratory system and skin. And it is harmful if swallowed. |
| Flash Point: | 185.8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
