| Identification | |
| Name: | hexafluorobenzene |
| Synonyms: | Perfluorobenzene |
| CAS: | 392-56-3 |
| EINECS: | 206-876-2 |
| Molecular Formula: | C6F6 |
| Molecular Weight: | 186.05 |
| InChI: | InChI=1/C6F6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.612 |
| Stability: | Stable. Incompatible with strong oxidizing agents. May form complexes with transition metals which can explode when heated. Highly flammable. |
| Refractive index: | 1.376-1.378 |
| Water Solubility: | Stable. Incompatible with strong oxidizing agents. May form complexes with transition metals which can explode when heated. Highly flammable |
| Solubility: | Stable. Incompatible with strong oxidizing agents. May form complexes with transition metals which can explode when heated. Highly flammable |
| Appearance: | colourless liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
