| Identification | |
| Name: | Benzenamine,4-methoxy-N-(4-methylphenyl)- |
| Synonyms: | Diphenylamine,4-methoxy-4'-methyl- (4CI);p-Anisidine, N-p-tolyl- (6CI);4-Methoxy-4'-methyldiphenylamine;4-Methoxy-N-(4-methylphenyl)aniline;4'-Methoxy-4-methyldiphenylamine;N-(4-Methoxyphenyl)-N-(4-methylphenyl)amine;p-Methoxyphenyl(p-methylphenyl)amine; |
| CAS: | 39253-43-5 |
| Molecular Formula: | C14H15NO |
| Molecular Weight: | 213.27 |
| InChI: | InChI=1/C14H15NO/c1-11-3-5-12(6-4-11)15-13-7-9-14(16-2)10-8-13/h3-10,15H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.602 |
| Specification: |
The N-(4-Methoxyphenyl)-4-methylbenzenamine with cas registry number of 39253-43-5, its systematic name is 4-methoxy-N-(4-methylphenyl)aniline. And it is also named benzenamine, 4-methoxy-N-(4-methylphenyl)-; 4-Methoxy-N-(4-methylphenyl)aniline. Physical properties about this chemical are: (1)ACD/LogP: 4.03; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 218; (6)ACD/BCF (pH 7.4): 218; (7)ACD/KOC (pH 5.5): 1640; (8)ACD/KOC (pH 7.4): 1641; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 21.26 Ã2; (13)Index of Refraction: 1.602; (14)Molar Refractivity: 67.131 cm3; (15)Molar Volume: 195.752 cm3; (16)Polarizability: 26.613×10-24cm3; (17)Surface Tension: 40.866 dyne/cm; (18)Enthalpy of Vaporization: 60.004 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
