| Identification | |
| Name: | Dinocap |
| Synonyms: | Caprane;Carathane; Crotothane; DPC; DPC (pesticide); Dinocap; Karathane; Karathane 25;Karathane FN 57; Karathane LC; Mildex |
| CAS: | 39300-45-3 |
| EINECS: | 254-408-0 |
| Molecular Formula: | C18H24 N2 O6 |
| Molecular Weight: | 364.3930 |
| InChI: | InChI=1S/C10H9NO4/c1-2-5-10(12)15-9-7-4-3-6-8(9)11(13)14/h2-7H,1H3/b5-2+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Flash Point: | 173.9°C |
| Density: | 1.1 |
| Stability: | No data. |
| Refractive index: | 1.54 |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble |
| Appearance: | Dark oily liquid. |
| Specification: |
Dinocap (39300-45-3) also can be called Meptyldinocap ; (E)-4,6-Dinitrophenyl 2-(1-methylheptyl)-2-butenoate ; (E)-2-Butenoic Acid 2-(1-Methylheptyl)-4,6-dinitrophenyl Ester ;Antimony fluoride ; 2,4-dinitro-6-(octan-2-yl)phenyl (2E)-but-2-enoate ; 2,4-Dinitro-6-(2-octanyl)phenyl-(2E)-2-butenoat . |
| Packinggroup: | I |
| Flash Point: | 173.9°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Acaricide, fungicide. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
