| Identification | |
| Name: | Acetic acid,2-methoxy-, ethyl ester |
| Synonyms: | Aceticacid, methoxy-, ethyl ester (6CI,7CI,8CI,9CI);Ethyl 2-methoxyacetate;Ethylmethoxyacetate;Methoxyacetic acid ethyl ester;NSC 245101; |
| CAS: | 3938-96-3 |
| EINECS: | 223-521-7 |
| Molecular Formula: | C5H10O3 |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1/C5H10O3/c1-3-8-5(6)4-7-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Density: | 1.007 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.3985-1.4015 |
| Solubility: | Soluble |
| Appearance: | clear, colorless liquid |
| Specification: |
2-Methoxy ethyl acetate , its CAS NO. is 3938-96-3, the synonyms are EINECS 223-521-7 ; Ethyl methoxyacetate ; NSC 245101 ; Acetic acid, methoxy-, ethyl ester (8CI)(9CI) . |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
