| Identification |
| Name: | Ethanone,1-(5-fluoro-2-hydroxyphenyl)- |
| Synonyms: | Acetophenone,5'-fluoro-2'-hydroxy- (6CI,7CI,8CI);1-(5-fluoro-2-hydroxyphenyl)ethanone;2-Acetyl-4-fluorophenol;2'-Hydroxy-5'-fluoroacetophenone;3-Fluoro-6-hydroxyacetophenone;NSC 46624; |
| CAS: | 394-32-1 |
| EINECS: | 206-893-5 |
| Molecular Formula: | C8H7FO2 |
| Molecular Weight: | 154.14 |
| InChI: | InChI=1/C8H7FO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.247g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.581 |
| Water Solubility: | soluble 0.68 g/L |
| Solubility: | soluble 0.68 g/L |
| Appearance: | Yellow to brown solid. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
