| Identification |
| Name: | Benzoic acid,4-[[6-[(aminoiminomethyl)amino]-1-oxohexyl]oxy]-, ethyl ester |
| Synonyms: | Gabexate;p-Carbethoxyphenyl e-guanidineocaproate;p-Carbethoxyphenyl e-guanidinocaproate;GABEXATE MESYLATE; |
| CAS: | 39492-01-8 |
| Molecular Formula: | C16H23N3O4 |
| Molecular Weight: | 321.37 |
| InChI: | InChI=1/C16H23N3O4.CH4O3S/c1-2-22-15(21)12-7-9-13(10-8-12)23-14(20)6-4-3-5-11-19-16(17)18;1-5(2,3)4/h7-10H,2-6,11H2,1H3,(H4,17,18,19);1H3,(H,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 261.4°C |
| Boiling Point: | 508.6°Cat760mmHg |
| Density: | 1.2g/cm3 |
| Biological Activity: | Serine protease inhibitor; inhibits trypsin, plasmin, plasma kallikrein and thrombin (IC 50 values are 9.4, 30, 41 and 110 mM respectively). Antithrombotic in vitro and in vivo . Also inhibits LPS-induced TNF- α production, probably by inhibiting NF- κ B and AP-1 activation. |
| Flash Point: | 261.4°C |
| Safety Data |
| |
 |
