| Identification | |
| Name: | Propanedioic acid,2-(2-methylpropyl)-, 1,3-dimethyl ester |
| Synonyms: | Propanedioicacid, (2-methylpropyl)-, dimethyl ester (9CI); Dimethyl isobutylmalonate |
| CAS: | 39520-24-6 |
| EINECS: | 254-490-8 |
| Molecular Formula: | C9H16 O4 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C9H16O4/c1-6(2)5-7(8(10)12-3)9(11)13-4/h6-7H,5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208? |
| Density: | 1.012 |
| Refractive index: | 1.423-1.425 |
| Appearance: | colorless to light yellow clear liquid |
| Specification: |
Propanedioic acid, 2-(2-methylpropyl)-, 1,3-dimethyl ester (CAS NO.39520-24-6) is also called Malonic acid, isobutyl-, dimethyl ester ; Dimethyl isobutylmalonate ; Propanedioic acid, (2-methylpropyl)-, dimethyl ester ; Propanedioic acid, 2-(2-methylpropyl)-, 1,3-dimethyl ester . Propanedioic acid, 2-(2-methylpropyl)-, 1,3-dimethyl ester (CAS NO.39520-24-6) is clear colorless to light yellow liquid. |
| Flash Point: | 208? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
