| Identification | |
| Name: | Isonipecotamide |
| Synonyms: | 4-Piperidinecarboxamide;3,4,5,6-tetrahydro-2H-pyridine-4-carboxamide;Piperidine-4-Carboxiamide; |
| CAS: | 39546-32-2 |
| EINECS: | 254-501-6 |
| Molecular Formula: | C6H12N2O |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C6H12N2O/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2,(H2,7,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 142.3 ºC |
| Boiling Point: | 311.7 ºC at 760 mmHg |
| Density: | 1.06 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | White to light yellow crystalline powder |
| Specification: |
Isonipecotamide (CAS NO.39546-32-2), its Synonyms are 4-Piperidinecarboxamide ; Hexahydroisonicotinamide ; Piperidine-4-carboxamide . |
| Flash Point: | 142.3 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
