| Identification | |
| Name: | Piperazine,1-(3-chlorophenyl)-4-(3-chloropropyl)- |
| Synonyms: | Piperazine,1-(m-chlorophenyl)-4-(3-chloropropyl)- (6CI);1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine; 1-(3-Chloropropyl)-4-(3-chlorophenyl)piperazine;1-[4-(3-Chlorophenyl)piperazin-1-yl]-3-chloropropane;3-[4-(3-Chlorophenyl)piperazin-1-yl]propyl chloride; NSC 520934 |
| CAS: | 39577-43-0 |
| EINECS: | 254-529-9 |
| Molecular Formula: | C13H18 Cl2 N2 |
| Molecular Weight: | 309.67 |
| InChI: | InChI=1S/C13H18Cl2N2/c14-5-2-6-16-7-9-17(10-8-16)13-4-1-3-12(15)11-13/h1,3-4,11H,2,5-10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 199 - 204 C |
| Flash Point: | 193.2°C |
| Boiling Point: | 395.8°Cat760mmHg |
| Density: | 1.186 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5715 (25 C) |
| Appearance: | white to yellowish crystalline powder |
| Specification: |
piperazine, 1-(3-chlorophenyl)-4-(3-chloropropyl)- , with CAS number of 39577-43-0, can be called 1-(3-Chloropropyl)-4-(3-chlorophenyl)piperazine ; 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine (CCP) . It is a white to beige powder. |
| Flash Point: | 193.2°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
