| Identification | |
| Name: | 1H-Indole-2,3-dione,5,7-dimethyl- |
| Synonyms: | 1H-Indole-2,3-dione, 5,7-dimethyl- (9CI);5,7-Dimethyl-1H-indole-2,3-dione;5,7-Dimethylindoline-2,3-dione;Indole-2,3-dione, 5,7-dimethyl-;BRN 0143679; |
| CAS: | 39603-24-2 |
| EINECS: | -0 |
| Molecular Formula: | C10H9NO2 |
| Molecular Weight: | 175.18 |
| InChI: | InChI=1/C10H9NO2/c1-5-3-6(2)8-7(4-5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 245 °C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.586 |
| Solubility: | Insoluble in water |
| Appearance: | Red to red-brown powder |
| Specification: |
Chemical Properties: 5,7-Dimethylisatin (39603-24-2) is red to red-brown powder. |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
