Identification |
Name: | 1H-Indole-2,3-dione,5,7-dimethyl- |
Synonyms: | 1H-Indole-2,3-dione, 5,7-dimethyl- (9CI);5,7-Dimethyl-1H-indole-2,3-dione;5,7-Dimethylindoline-2,3-dione;Indole-2,3-dione, 5,7-dimethyl-;BRN 0143679; |
CAS: | 39603-24-2 |
EINECS: | -0 |
Molecular Formula: | C10H9NO2 |
Molecular Weight: | 175.18 |
InChI: | InChI=1/C10H9NO2/c1-5-3-6(2)8-7(4-5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13) |
Molecular Structure: |
 |
Properties |
Melting Point: | 245 °C
|
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.25g/cm3 |
Refractive index: | 1.586 |
Solubility: | Insoluble in water |
Appearance: | Red to red-brown powder |
Specification: |
Chemical Properties: 5,7-Dimethylisatin (39603-24-2) is red to red-brown powder.
|
Flash Point: | °C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |