| Identification | |
| Name: | Cyclohexanecarboxamide,N-ethyl-5-methyl-2-(1-methylethyl)- |
| Synonyms: | CoolingSensate WS 3;Ethyl menthane carboxamide;WS3;WS 3 (amide); |
| CAS: | 39711-79-0 |
| EINECS: | 254-599-0 |
| Molecular Formula: | C13H25NO |
| Molecular Weight: | 211.35 |
| InChI: | InChI=1/C13H25NO/c1-5-14-13(15)12-8-10(4)6-7-11(12)9(2)3/h9-12H,5-8H2,1-4H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.898 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.454 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble IN WATER |
| Appearance: | White crystal |
| Specification: |
N-Ethyl-p-menthane-3-carboxamide (CAS NO.39711-79-0), its Synonyms are Cyclohexanecarboxamide, N-ethyl-5-methyl-2-(1-methylethyl)- ; Ethyl menthane carboxamide ; N-Ethyl-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide ; N-Ethyl-2-isopropyl-5-methylcyclohexane carboxamide ; WS-3 . It is white crystalline powder. |
| Biological Activity: | Cooling agent that is an agonist at TRPM8 receptors (EC 50 = 3.7 μ M). |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Physiological coolant in foods, beverages, toiletries, cosmetics and pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
