| Identification | |
| Name: | Benzenemethanethiol,2-chloro- |
| Synonyms: | (2-Chlorophenyl)methanethiol;(o-Chlorophenyl)methanethiol; 2-Chlorobenzenemethanethiol; 2-Chlorobenzylmercaptan; 2-Chlorotoluene-a-thiol; o-Chlorobenzyl mercaptan; o-Chlorobenzylthiol |
| CAS: | 39718-00-8 |
| EINECS: | 254-602-5 |
| Molecular Formula: | C7H7 Cl S |
| Molecular Weight: | 158.6513 |
| InChI: | InChI=1/C7H7ClS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Density: | 1.204 g/cm3 |
| Refractive index: | 1.5904 |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
2-Chlorobenzyl mercaptan ,with CAS number of 39718-00-8,can be called benzenemethanethiol, 2-chloro- .It is a clear colorless to light yellow liquid. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
