| Identification | |
| Name: | Alminoprofen |
| Synonyms: | Almiluofen;Sedaspray |
| CAS: | 39718-89-3 |
| EINECS: | 254-604-6 |
| Molecular Formula: | C13H17NO2 |
| Molecular Weight: | 219.28 |
| InChI: | InChI=1/C13H17NO2/c1-9(2)8-14-12-6-4-11(5-7-12)10(3)13(15)16/h4-7,10,14H,1,8H2,2-3H3,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.107g/cm3 |
| Refractive index: | 1.571 |
| Specification: |
Alminoprofen with CAS Registry Number of 39718-89-3 is white waxy crystals. It is also known as Alminoprofen [INN:JAN] ; 2-(4-((2-Methylallyl)amino)phenyl)propansaeure ; 2-(4-(Methallylamino)phenyl)propionic acid ; 4-((2-Methylallyl)amino)hydratropasaeure ; Acide (methallylamino-4 phenyl)-2 propionique ; Acide (methallylamino-4 phenyl)-2 propionique [French] ; Alminoprofene ; Alminoprofene [INN-French] ; Alminoprofeno ; Alminoprofeno [INN-Spanish] ; Alminoprofeno [Spanish] ; Alminoprofenum ; Alminoprofenum [INN-Latin] ; Benzeneacetic acid, alpha-methyl-4-((2-methyl-2-propenyl)amino)- ; EB 382 ; EB-382 ; Minalfene ; UNII-0255AHR9GJ ; alpha-Methyl-4-((2-methyl-2-propenyl)amino)benzeneacetic acid ; p-((2-Methylallyl)amino)hydratropic acid ; Propionic acid, 2-(4-(methallylamino)phenyl)- . It is a non-steroidal anti-inflammatory drug better than Ibuprofen . |
| Safety Data | |
 |
|
