| Identification | |
| Name: | Benzoic acid, 4-nitro-,2-phenylhydrazide |
| Synonyms: | Benzoicacid, p-nitro-, 2-phenylhydrazide (6CI); 4-Nitrobenzoic acid phenylhydrazide;NSC 406774; p-Nitrobenzoic acid phenylhydrazide; p-Nitrobenzoicphenylhydrazide; b-p-Nitrobenzoylphenylhydrazine |
| CAS: | 39718-99-5 |
| Molecular Formula: | C13H11 N3 O3 |
| Molecular Weight: | 257.27 |
| InChI: | InChI=1/C13H11N3O3/c17-13(15-14-11-4-2-1-3-5-11)10-6-8-12(9-7-10)16(18)19/h1-9,14H,(H,15,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 200.3°C |
| Boiling Point: | 407.5°C at 760 mmHg |
| Density: | 1.361g/cm3 |
| Refractive index: | 1.674 |
| Specification: |
p-Nitrobenzoic acid 2-phenylhydrazide , its cas register number is 39718-99-5. It also can be called 3-15-00-00164 (Beilstein Handbook Reference) ; AI3-07778 ; BRN 1843565 ; NSC 406774 . When heated to decomposition it emits toxic vapors of NOx. |
| Flash Point: | 200.3°C |
| Safety Data | |
 |
|
