| Identification | |
| Name: | Pyridinium,1-methyl-4-phenyl-, chloride (1:1) |
| Synonyms: | Pyridinium,1-methyl-4-phenyl-, chloride (9CI); 1-Methyl-4-phenylpyridinium chloride;4-Phenyl-1-methylpyridinium chloride; Cyperquat chloride; S 21634 |
| CAS: | 39794-99-5 |
| Molecular Formula: | C12H12 N . Cl |
| Molecular Weight: | 205.70 |
| InChI: | InChI=1S/C12H12N/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3/q+1 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
1-Methyl-4-phenylpyridinium chloride with cas registry number of 39794-99-5 is also known as 1-Methyl-4-phenylpyridinium chloride ; Cyperquat chloride ; Pyridinium,1-methyl-4-phenyl-, chloride . This substance is a derivative of cyperquat and it is toxic to human beings when swallowed. 1-Methyl-4-phenylpyridinium chloride with cas registry number of 39794-99-5 is used as a herbicide . It is quick-acting and non-selective, killing green plant tissue on contact. It is non-selective, which means it kills a wide range of annual grasses and broad-leaved weeds and the tops of established perennial weeds. |
| Safety Data | |
 |
|
