| Identification |
| Name: | 1,2-Eicosanediol |
| Synonyms: | icosane-1,2-diol;ARACHIDYL GLYCOL;1,2-Dihydroxy-eicosane;1,2-Eicosanediol |
| CAS: | 39825-93-9 |
| EINECS: | 254-647-0 |
| Molecular Formula: | C20H42 O2 |
| Molecular Weight: | 314.54628 |
| InChI: | InChI=1/C20H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)19-21/h20-22H,2-19H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 183.7°C |
| Boiling Point: | 435.2°Cat760mmHg |
| Density: | 0.888g/cm3 |
| Refractive index: | 1.464 |
| Flash Point: | 183.7°C |
| Usage: | Diols have good antifoaming properties; used for sunscreen, detergent and hair cosmetics |
| Safety Data |
| |
 |
