Identification |
Name: | Benzoyl chloride,2,4-dimethoxy- |
Synonyms: | 2,4-Dimethoxybenzoylchloride; |
CAS: | 39828-35-8 |
Molecular Formula: | C9H9ClO3 |
Molecular Weight: | 200.62 |
InChI: | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3261 8 |
Density: | 1.224 g/cm3 |
Refractive index: | 1.52 |
Appearance: | beige to light brown powder / beige to light brown powder |
Packinggroup: | II |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |