| Identification | |
| Name: | Benzeneacetylchloride, a-amino-, hydrochloride, (R)- |
| CAS: | 39878-87-0 |
| EINECS: | 254-668-5 |
| Molecular Formula: | C8H8ClNO.HCl |
| Molecular Weight: | 206.07 |
| InChI: | InChI=1/C8H8ClNO.ClH/c9-8(11)7(10)6-4-2-1-3-5-6;/h1-5,7H,10H2;1H/t7-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 117 C |
| Density: | g/cm3 |
| Solubility: | Appearance:white to off white crystalline powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | white to off white crystalline powder |
| Safety Data | |
| Hazard Symbols | |
 |
|
