| Identification | |
| Name: | Cyclopentaneaceticacid, 3-oxo-2-(2-penten-1-yl)-, methyl ester |
| Synonyms: | Cyclopentaneaceticacid, 3-oxo-2-(2-pentenyl)-, methyl ester (7CI,9CI);Methyl 2-pentenyl-3-oxocyclopentaneacetate; |
| CAS: | 39924-52-2 |
| EINECS: | 254-705-5 |
| Molecular Formula: | C13H20O3 |
| Molecular Weight: | 224.30 . |
| InChI: | InChI=1/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | REM |
| Boiling Point: | 110 C |
| Density: | 1.003 g/cm3 |
| Refractive index: | n20/D 1.474(lit.) |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble
Appearance:Clear to pale yellow liquid Transport Information: REM Hazard Symbols:UN NO. |
| Appearance: | Clear to pale yellow liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
